C20H32O3 — CID 163023871
(4R)-6-[(1S,4aR,8aR)-5,5,8a-trimethyl-6-oxo-4,4a,7,8-tetrahydro-1H-naphthalen-1-yl]-4-methylhexanoic acid (PubChem CID 163023871) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (4R)-6-[(1S,4aR,8aR)-5,5,8a-trimethyl-6-oxo-4,4a,7,8-tetrahydro-1H-naphthalen-1-yl]-4-methylhexanoic acid.
| Compound Name | (4R)-6-[(1S,4aR,8aR)-5,5,8a-trimethyl-6-oxo-4,4a,7,8-tetrahydro-1H-naphthalen-1-yl]-4-methylhexanoic acid |
|---|---|
| PubChem CID | 163023871 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (4R)-6-[(1S,4aR,8aR)-5,5,8a-trimethyl-6-oxo-4,4a,7,8-tetrahydro-1H-naphthalen-1-yl]-4-methylhexanoic acid |
| SMILES | C[C@@H](CCC(=O)O)CC[C@H]1C=CC[C@H]2C(C)(C)C(=O)CC[C@]12C |
| InChI | InChI=1S/C20H32O3/c1-14(9-11-18(22)23)8-10-15-6-5-7-16-19(2,3)17(21)12-13-20(15,16)4/h5-6,14-16H,7-13H2,1-4H3,(H,22,23)/t14-,15-,16+,20-/m1/s1 |
| InChIKey | WFFPYISFOFMHHG-IHSNIMORSA-N |
| XLogP | 4.86 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|