C23H29NO6 — CID 163025247
(5E)-4-methoxy-3-methyl-5-[(1S,2R,3S,11S)-3-methyl-11-[(2S,4S)-4-methyl-5-oxooxolan-2-yl]-5-oxa-10-azatricyclo[8.3.0.02,6]tridec-6-en-4-ylidene]furan-2-one (PubChem CID 163025247) has the molecular formula C23H29NO6 and a molecular weight of 415.49 g/mol. Its IUPAC name is (5E)-4-methoxy-3-methyl-5-[(1S,2R,3S,11S)-3-methyl-11-[(2S,4S)-4-methyl-5-oxooxolan-2-yl]-5-oxa-10-azatricyclo[8.3.0.02,6]tridec-6-en-4-ylidene]furan-2-one.
| Compound Name | (5E)-4-methoxy-3-methyl-5-[(1S,2R,3S,11S)-3-methyl-11-[(2S,4S)-4-methyl-5-oxooxolan-2-yl]-5-oxa-10-azatricyclo[8.3.0.02,6]tridec-6-en-4-ylidene]furan-2-one |
|---|---|
| PubChem CID | 163025247 |
| Molecular Formula | C23H29NO6 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | (5E)-4-methoxy-3-methyl-5-[(1S,2R,3S,11S)-3-methyl-11-[(2S,4S)-4-methyl-5-oxooxolan-2-yl]-5-oxa-10-azatricyclo[8.3.0.02,6]tridec-6-en-4-ylidene]furan-2-one |
| SMILES | COC1=C(C)C(=O)O/C1=C1/OC2=CCCN3[C@@H](CC[C@H]3[C@@H]3C[C@H](C)C(=O)O3)[C@H]2[C@@H]1C |
| InChI | InChI=1S/C23H29NO6/c1-11-10-17(29-22(11)25)14-7-8-15-18-12(2)20(28-16(18)6-5-9-24(14)15)21-19(27-4)13(3)23(26)30-21/h6,11-12,14-15,17-18H,5,7-10H2,1-4H3/b21-20+/t11-,12-,14-,15-,17-,18+/m0/s1 |
| InChIKey | NYZQJBRFZJFPKA-AUJUDHOHSA-N |
| XLogP | 3.03 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |