C20H28O4 — CID 163025629
[(1R,2R,8aR)-1,8a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,8-tetrahydro-1H-naphthalen-2-yl] (2S,3R)-2,3-dimethyloxirane-2-carboxylate (PubChem CID 163025629) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is [(1R,2R,8aR)-1,8a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,8-tetrahydro-1H-naphthalen-2-yl] (2S,3R)-2,3-dimethyloxirane-2-carboxylate.
| Compound Name | [(1R,2R,8aR)-1,8a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,8-tetrahydro-1H-naphthalen-2-yl] (2S,3R)-2,3-dimethyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 163025629 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | [(1R,2R,8aR)-1,8a-dimethyl-6-oxo-7-propan-2-ylidene-2,3,4,8-tetrahydro-1H-naphthalen-2-yl] (2S,3R)-2,3-dimethyloxirane-2-carboxylate |
| SMILES | CC(C)=C1C[C@@]2(C)C(=CC1=O)CC[C@@H](OC(=O)[C@@]1(C)O[C@@H]1C)[C@@H]2C |
| InChI | InChI=1S/C20H28O4/c1-11(2)15-10-19(5)12(3)17(8-7-14(19)9-16(15)21)23-18(22)20(6)13(4)24-20/h9,12-13,17H,7-8,10H2,1-6H3/t12-,13+,17+,19+,20-/m0/s1 |
| InChIKey | YIBWHVLFXMVMLL-HZZAMGJNSA-N |
| XLogP | 3.75 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|