C17H32N2 — CID 163026405
1,7-dimethyl-5-(piperidin-2-ylmethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 163026405) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is 1,7-dimethyl-5-(piperidin-2-ylmethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | 1,7-dimethyl-5-(piperidin-2-ylmethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 163026405 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | 1,7-dimethyl-5-(piperidin-2-ylmethyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | CC1CC(CC2CCCCN2)C2CCCN(C)C2C1 |
| InChI | InChI=1S/C17H32N2/c1-13-10-14(12-15-6-3-4-8-18-15)16-7-5-9-19(2)17(16)11-13/h13-18H,3-12H2,1-2H3 |
| InChIKey | PDUPMKGQCAJLPD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |