C20H32O3 — CID 163028462
(1R,3R,4E,6S,8S,10E,13E)-1,5,11-trimethyl-8-prop-1-en-2-ylcyclotetradeca-4,10,13-triene-1,3,6-triol (PubChem CID 163028462) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (1R,3R,4E,6S,8S,10E,13E)-1,5,11-trimethyl-8-prop-1-en-2-ylcyclotetradeca-4,10,13-triene-1,3,6-triol.
| Compound Name | (1R,3R,4E,6S,8S,10E,13E)-1,5,11-trimethyl-8-prop-1-en-2-ylcyclotetradeca-4,10,13-triene-1,3,6-triol |
|---|---|
| PubChem CID | 163028462 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (1R,3R,4E,6S,8S,10E,13E)-1,5,11-trimethyl-8-prop-1-en-2-ylcyclotetradeca-4,10,13-triene-1,3,6-triol |
| SMILES | C=C(C)[C@H]1C/C=C(\C)C/C=C/[C@](C)(O)C[C@@H](O)/C=C(\C)[C@@H](O)C1 |
| InChI | InChI=1S/C20H32O3/c1-14(2)17-9-8-15(3)7-6-10-20(5,23)13-18(21)11-16(4)19(22)12-17/h6,8,10-11,17-19,21-23H,1,7,9,12-13H2,2-5H3/b10-6+,15-8+,16-11+/t17-,18-,19-,20-/m0/s1 |
| InChIKey | NMAOWZNPWXGFTF-IUFWWUAMSA-N |
| XLogP | 3.67 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|