C20H26N2O4S — CID 163029194
N-[1-[4-[6-(2-hydroxy-2-methyl-5-oxocyclohexyl)-5-oxohexa-1,3-dienyl]-1,3-thiazol-2-yl]ethyl]acetamide (PubChem CID 163029194) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is N-[1-[4-[6-(2-hydroxy-2-methyl-5-oxocyclohexyl)-5-oxohexa-1,3-dienyl]-1,3-thiazol-2-yl]ethyl]acetamide.
| Compound Name | N-[1-[4-[6-(2-hydroxy-2-methyl-5-oxocyclohexyl)-5-oxohexa-1,3-dienyl]-1,3-thiazol-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 163029194 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-[1-[4-[6-(2-hydroxy-2-methyl-5-oxocyclohexyl)-5-oxohexa-1,3-dienyl]-1,3-thiazol-2-yl]ethyl]acetamide |
| SMILES | CC(=O)NC(C)c1nc(C=CC=CC(=O)CC2CC(=O)CCC2(C)O)cs1 |
| InChI | InChI=1S/C20H26N2O4S/c1-13(21-14(2)23)19-22-16(12-27-19)6-4-5-7-17(24)10-15-11-18(25)8-9-20(15,3)26/h4-7,12-13,15,26H,8-11H2,1-3H3,(H,21,23) |
| InChIKey | SQWIUXIQFDGCBG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|