C16H22N2O4S — CID 6425497
methyl (2E,4E)-5-[2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1,3-thiazol-4-yl]penta-2,4-dienoate (PubChem CID 6425497) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is methyl (2E,4E)-5-[2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1,3-thiazol-4-yl]penta-2,4-dienoate.
| Compound Name | methyl (2E,4E)-5-[2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1,3-thiazol-4-yl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 6425497 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | methyl (2E,4E)-5-[2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1,3-thiazol-4-yl]penta-2,4-dienoate |
| SMILES | COC(=O)/C=C/C=C/c1csc(C(C)NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C16H22N2O4S/c1-11(17-15(20)22-16(2,3)4)14-18-12(10-23-14)8-6-7-9-13(19)21-5/h6-11H,1-5H3,(H,17,20)/b8-6+,9-7+ |
| InChIKey | NYXVAXREJALPMP-CDJQDVQCSA-N |
| XLogP | 3.47 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|