C9H15N3O2S — CID 130913963
tert-butyl N-[1-(thiadiazol-4-yl)ethyl]carbamate (PubChem CID 130913963) has the molecular formula C9H15N3O2S and a molecular weight of 229.31 g/mol. Its IUPAC name is tert-butyl N-[1-(thiadiazol-4-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-(thiadiazol-4-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 130913963 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | tert-butyl N-[1-(thiadiazol-4-yl)ethyl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)c1csnn1 |
| InChI | InChI=1S/C9H15N3O2S/c1-6(7-5-15-12-11-7)10-8(13)14-9(2,3)4/h5-6H,1-4H3,(H,10,13) |
| InChIKey | VXOHGSVMTQTZMJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |