C17H28O3 — CID 163031761
(4aR,6aS,9S,10aS,10bR)-9-hydroxy-4a,7,7,10a-tetramethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-3-one (PubChem CID 163031761) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is (4aR,6aS,9S,10aS,10bR)-9-hydroxy-4a,7,7,10a-tetramethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-3-one.
| Compound Name | (4aR,6aS,9S,10aS,10bR)-9-hydroxy-4a,7,7,10a-tetramethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 163031761 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | (4aR,6aS,9S,10aS,10bR)-9-hydroxy-4a,7,7,10a-tetramethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-3-one |
| SMILES | CC1(C)C[C@H](O)C[C@]2(C)[C@H]3CCC(=O)O[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C17H28O3/c1-15(2)9-11(18)10-16(3)12(15)7-8-17(4)13(16)5-6-14(19)20-17/h11-13,18H,5-10H2,1-4H3/t11-,12-,13+,16-,17+/m0/s1 |
| InChIKey | UFBUDGKCVXEAIH-LVSLPLRBSA-N |
| XLogP | 3.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |