C27H36O6 — CID 163032058
[(1R,3E,7E,11Z)-4,8-dimethyl-11-[(5S)-5-(2-methylprop-1-enyl)-2-oxooxolan-3-ylidene]-1-(5-oxo-2H-furan-3-yl)undeca-3,7-dienyl] acetate (PubChem CID 163032058) has the molecular formula C27H36O6 and a molecular weight of 456.58 g/mol. Its IUPAC name is [(1R,3E,7E,11Z)-4,8-dimethyl-11-[(5S)-5-(2-methylprop-1-enyl)-2-oxooxolan-3-ylidene]-1-(5-oxo-2H-furan-3-yl)undeca-3,7-dienyl] acetate.
| Compound Name | [(1R,3E,7E,11Z)-4,8-dimethyl-11-[(5S)-5-(2-methylprop-1-enyl)-2-oxooxolan-3-ylidene]-1-(5-oxo-2H-furan-3-yl)undeca-3,7-dienyl] acetate |
|---|---|
| PubChem CID | 163032058 |
| Molecular Formula | C27H36O6 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | [(1R,3E,7E,11Z)-4,8-dimethyl-11-[(5S)-5-(2-methylprop-1-enyl)-2-oxooxolan-3-ylidene]-1-(5-oxo-2H-furan-3-yl)undeca-3,7-dienyl] acetate |
| SMILES | CC(=O)O[C@H](C/C=C(\C)CC/C=C(\C)CC/C=C1/C[C@@H](C=C(C)C)OC1=O)C1=CC(=O)OC1 |
| InChI | InChI=1S/C27H36O6/c1-18(2)14-24-15-22(27(30)33-24)11-7-10-19(3)8-6-9-20(4)12-13-25(32-21(5)28)23-16-26(29)31-17-23/h8,11-12,14,16,24-25H,6-7,9-10,13,15,17H2,1-5H3/b19-8+,20-12+,22-11-/t24-,25-/m1/s1 |
| InChIKey | GQLPZEDSWZUFKJ-KAOAGCLDSA-N |
| XLogP | 5.45 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|