C16H16O7 — CID 163033248
methyl (1S,2S,3R)-2,3,8-trihydroxy-6-methyl-9-oxo-1,2,3,4-tetrahydroxanthene-1-carboxylate (PubChem CID 163033248) has the molecular formula C16H16O7 and a molecular weight of 320.30 g/mol. Its IUPAC name is methyl (1S,2S,3R)-2,3,8-trihydroxy-6-methyl-9-oxo-1,2,3,4-tetrahydroxanthene-1-carboxylate.
| Compound Name | methyl (1S,2S,3R)-2,3,8-trihydroxy-6-methyl-9-oxo-1,2,3,4-tetrahydroxanthene-1-carboxylate |
|---|---|
| PubChem CID | 163033248 |
| Molecular Formula | C16H16O7 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | methyl (1S,2S,3R)-2,3,8-trihydroxy-6-methyl-9-oxo-1,2,3,4-tetrahydroxanthene-1-carboxylate |
| SMILES | COC(=O)[C@H]1c2c(oc3cc(C)cc(O)c3c2=O)C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H16O7/c1-6-3-7(17)11-9(4-6)23-10-5-8(18)14(19)13(16(21)22-2)12(10)15(11)20/h3-4,8,13-14,17-19H,5H2,1-2H3/t8-,13+,14-/m1/s1 |
| InChIKey | UGJKECHXCXKYNU-NFMODRRSSA-N |
| XLogP | 0.34 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |