C25H40O7 — CID 163033255
12,12-dimethyl-16-(3-methylbutoxy)-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecane-3,7,9,10,18-pentol (PubChem CID 163033255) has the molecular formula C25H40O7 and a molecular weight of 452.59 g/mol. Its IUPAC name is 12,12-dimethyl-16-(3-methylbutoxy)-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecane-3,7,9,10,18-pentol.
| Compound Name | 12,12-dimethyl-16-(3-methylbutoxy)-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecane-3,7,9,10,18-pentol |
|---|---|
| PubChem CID | 163033255 |
| Molecular Formula | C25H40O7 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | 12,12-dimethyl-16-(3-methylbutoxy)-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecane-3,7,9,10,18-pentol |
| SMILES | C=C1C2CC(O)C3C45CCCC(C)(C)C4C(O)C(O)(OC5OCCC(C)C)C3(C1O)C2O |
| InChI | InChI=1S/C25H40O7/c1-12(2)7-10-31-21-23-9-6-8-22(4,5)17(23)20(29)25(30,32-21)24-16(23)15(26)11-14(19(24)28)13(3)18(24)27/h12,14-21,26-30H,3,6-11H2,1-2,4-5H3 |
| InChIKey | HYEIYKWRVPNFES-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|