C22H34O8 — CID 56683362
(1S,2S,3S,5S,6R,8R,9S,10S,11R,16S,18R)-3,9,10,18-tetrahydroxy-16-methoxy-6-(methoxymethyl)-12,12-dimethyl-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-7-one (PubChem CID 56683362) has the molecular formula C22H34O8 and a molecular weight of 426.51 g/mol. Its IUPAC name is (1S,2S,3S,5S,6R,8R,9S,10S,11R,16S,18R)-3,9,10,18-tetrahydroxy-16-methoxy-6-(methoxymethyl)-12,12-dimethyl-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-7-one.
| Compound Name | (1S,2S,3S,5S,6R,8R,9S,10S,11R,16S,18R)-3,9,10,18-tetrahydroxy-16-methoxy-6-(methoxymethyl)-12,12-dimethyl-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-7-one |
|---|---|
| PubChem CID | 56683362 |
| Molecular Formula | C22H34O8 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | (1S,2S,3S,5S,6R,8R,9S,10S,11R,16S,18R)-3,9,10,18-tetrahydroxy-16-methoxy-6-(methoxymethyl)-12,12-dimethyl-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-7-one |
| SMILES | COC[C@@H]1C(=O)[C@]23[C@H](O)[C@H]1C[C@H](O)[C@H]2[C@@]12CCCC(C)(C)[C@H]1[C@H](O)[C@@]3(O)O[C@@H]2OC |
| InChI | InChI=1S/C22H34O8/c1-19(2)6-5-7-20-13-12(23)8-10-11(9-28-3)16(25)21(13,15(10)24)22(27,17(26)14(19)20)30-18(20)29-4/h10-15,17-18,23-24,26-27H,5-9H2,1-4H3/t10-,11-,12-,13-,14+,15+,17-,18-,20-,21+,22+/m0/s1 |
| InChIKey | PJMGRTQORMIETN-QVGZGZCOSA-N |
| XLogP | 0.05 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |