C30H50O5 — CID 163033258
(1R,2R,4aR,6aR,6aS,6bR,8aS,10R,11R,12aR,14bS)-9,9-bis(hydroxymethyl)-1,2,4a,6a,6b,12a-hexamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-1,10,11-triol (PubChem CID 163033258) has the molecular formula C30H50O5 and a molecular weight of 490.73 g/mol. Its IUPAC name is (1R,2R,4aR,6aR,6aS,6bR,8aS,10R,11R,12aR,14bS)-9,9-bis(hydroxymethyl)-1,2,4a,6a,6b,12a-hexamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-1,10,11-triol.
| Compound Name | (1R,2R,4aR,6aR,6aS,6bR,8aS,10R,11R,12aR,14bS)-9,9-bis(hydroxymethyl)-1,2,4a,6a,6b,12a-hexamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-1,10,11-triol |
|---|---|
| PubChem CID | 163033258 |
| Molecular Formula | C30H50O5 |
| Molecular Weight | 490.73 g/mol |
| Exact Mass | 490.37 |
| IUPAC Name | (1R,2R,4aR,6aR,6aS,6bR,8aS,10R,11R,12aR,14bS)-9,9-bis(hydroxymethyl)-1,2,4a,6a,6b,12a-hexamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-1,10,11-triol |
| SMILES | C[C@@H]1CC[C@]2(C)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@@H](O)[C@H](O)C(CO)(CO)[C@H]5CC[C@]43C)[C@H]2[C@]1(C)O |
| InChI | InChI=1S/C30H50O5/c1-18-9-11-25(2)13-14-27(4)19(23(25)29(18,6)35)7-8-21-26(3)15-20(33)24(34)30(16-31,17-32)22(26)10-12-28(21,27)5/h7,18,20-24,31-35H,8-17H2,1-6H3/t18-,20-,21-,22+,23-,24+,25-,26-,27-,28-,29-/m1/s1 |
| InChIKey | RLCUKXXGZYXKAF-GVRCQVSGSA-N |
| XLogP | 4.06 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.73 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|