C18H29NO5 — CID 163033792
4-ethylidene-7,12-dihydroxy-6,7-dimethyl-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadecan-8-one (PubChem CID 163033792) has the molecular formula C18H29NO5 and a molecular weight of 339.43 g/mol. Its IUPAC name is 4-ethylidene-7,12-dihydroxy-6,7-dimethyl-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadecan-8-one.
| Compound Name | 4-ethylidene-7,12-dihydroxy-6,7-dimethyl-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadecan-8-one |
|---|---|
| PubChem CID | 163033792 |
| Molecular Formula | C18H29NO5 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 4-ethylidene-7,12-dihydroxy-6,7-dimethyl-2,9-dioxa-14-azatricyclo[9.5.1.014,17]heptadecan-8-one |
| SMILES | CC=C1COC2CCN3CC(O)C(COC(=O)C(C)(O)C(C)C1)C23 |
| InChI | InChI=1S/C18H29NO5/c1-4-12-7-11(2)18(3,22)17(21)24-10-13-14(20)8-19-6-5-15(16(13)19)23-9-12/h4,11,13-16,20,22H,5-10H2,1-3H3 |
| InChIKey | RASUILXKRVIWQK-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|