C32H28O17 — CID 163035029
(2S,3R,4R,5S,6R)-6-[5,6-dihydroxy-3-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyloxy]-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 163035029) has the molecular formula C32H28O17 and a molecular weight of 684.56 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-6-[5,6-dihydroxy-3-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyloxy]-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3R,4R,5S,6R)-6-[5,6-dihydroxy-3-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyloxy]-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 163035029 |
| Molecular Formula | C32H28O17 |
| Molecular Weight | 684.56 g/mol |
| Exact Mass | 684.13 |
| IUPAC Name | (2S,3R,4R,5S,6R)-6-[5,6-dihydroxy-3-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyloxy]-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | COc1cc(C=CC(=O)Oc2c(-c3ccc(O)cc3)oc3cc(O[C@H]4O[C@H](C(=O)O)[C@H](O)[C@@H](O)[C@@H]4O)c(O)c(O)c3c2=O)cc(OC)c1O |
| InChI | InChI=1S/C32H28O17/c1-44-16-9-12(10-17(45-2)21(16)35)3-8-19(34)48-29-24(38)20-15(46-28(29)13-4-6-14(33)7-5-13)11-18(22(36)23(20)37)47-32-27(41)25(39)26(40)30(49-32)31(42)43/h3-11,25-27,30,32-33,35-37,39-41H,1-2H3,(H,42,43)/t25-,26-,27+,30+,32+/m1/s1 |
| InChIKey | GGCMOYFWUQLNES-RNXLWKNGSA-N |
| XLogP | 1.19 |
| TPSA | 272.34 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.56 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|