C22H20O12 — CID 24850405
7-[(3R,4S,5S,6S)-6-acetyl-3,4,5-trihydroxyoxan-2-yl]oxy-3,5,6-trihydroxy-2-(4-hydroxyphenyl)chromen-4-one (PubChem CID 24850405) has the molecular formula C22H20O12 and a molecular weight of 476.39 g/mol. Its IUPAC name is 7-[(3R,4S,5S,6S)-6-acetyl-3,4,5-trihydroxyoxan-2-yl]oxy-3,5,6-trihydroxy-2-(4-hydroxyphenyl)chromen-4-one.
| Compound Name | 7-[(3R,4S,5S,6S)-6-acetyl-3,4,5-trihydroxyoxan-2-yl]oxy-3,5,6-trihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 24850405 |
| Molecular Formula | C22H20O12 |
| Molecular Weight | 476.39 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 7-[(3R,4S,5S,6S)-6-acetyl-3,4,5-trihydroxyoxan-2-yl]oxy-3,5,6-trihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| SMILES | CC(=O)[C@H]1OC(Oc2cc3oc(-c4ccc(O)cc4)c(O)c(=O)c3c(O)c2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H20O12/c1-7(23)20-18(30)16(28)19(31)22(34-20)33-11-6-10-12(14(26)13(11)25)15(27)17(29)21(32-10)8-2-4-9(24)5-3-8/h2-6,16,18-20,22,24-26,28-31H,1H3/t16-,18-,19+,20+,22?/m0/s1 |
| InChIKey | OWBWJSWATJBVFE-YCUJNSNJSA-N |
| XLogP | 0.06 |
| TPSA | 207.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.39 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|