C33H38O11 — CID 163035331
[(1S,2S,4S,5R,6S,7S,9R,12R)-4,12-diacetyloxy-2-hydroxy-2,10,10-trimethyl-8-oxo-5,7-diphenoxy-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate (PubChem CID 163035331) has the molecular formula C33H38O11 and a molecular weight of 610.66 g/mol. Its IUPAC name is [(1S,2S,4S,5R,6S,7S,9R,12R)-4,12-diacetyloxy-2-hydroxy-2,10,10-trimethyl-8-oxo-5,7-diphenoxy-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate.
| Compound Name | [(1S,2S,4S,5R,6S,7S,9R,12R)-4,12-diacetyloxy-2-hydroxy-2,10,10-trimethyl-8-oxo-5,7-diphenoxy-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate |
|---|---|
| PubChem CID | 163035331 |
| Molecular Formula | C33H38O11 |
| Molecular Weight | 610.66 g/mol |
| Exact Mass | 610.24 |
| IUPAC Name | [(1S,2S,4S,5R,6S,7S,9R,12R)-4,12-diacetyloxy-2-hydroxy-2,10,10-trimethyl-8-oxo-5,7-diphenoxy-11-oxatricyclo[7.2.1.01,6]dodecan-6-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]12[C@H](Oc3ccccc3)C(=O)[C@@H]3[C@@H](OC(C)=O)[C@]1(OC3(C)C)[C@@](C)(O)C[C@H](OC(C)=O)[C@@H]2Oc1ccccc1 |
| InChI | InChI=1S/C33H38O11/c1-19(34)39-18-32-27(42-22-13-9-7-10-14-22)24(40-20(2)35)17-31(6,38)33(32)28(41-21(3)36)25(30(4,5)44-33)26(37)29(32)43-23-15-11-8-12-16-23/h7-16,24-25,27-29,38H,17-18H2,1-6H3/t24-,25+,27-,28+,29+,31-,32-,33-/m0/s1 |
| InChIKey | UYXVZENRQIZTDR-PEHHQXOISA-N |
| XLogP | 3.20 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.66 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|