C15H28O7S — CID 163035820
[(2R)-2-[(3S,3aS,5R,8R,8aS)-8,8a-dihydroxy-3,8-dimethyl-1,2,3,3a,4,5,6,7-octahydroazulen-5-yl]-2-hydroxypropyl] hydrogen sulfate (PubChem CID 163035820) has the molecular formula C15H28O7S and a molecular weight of 352.45 g/mol. Its IUPAC name is [(2R)-2-[(3S,3aS,5R,8R,8aS)-8,8a-dihydroxy-3,8-dimethyl-1,2,3,3a,4,5,6,7-octahydroazulen-5-yl]-2-hydroxypropyl] hydrogen sulfate.
| Compound Name | [(2R)-2-[(3S,3aS,5R,8R,8aS)-8,8a-dihydroxy-3,8-dimethyl-1,2,3,3a,4,5,6,7-octahydroazulen-5-yl]-2-hydroxypropyl] hydrogen sulfate |
|---|---|
| PubChem CID | 163035820 |
| Molecular Formula | C15H28O7S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | [(2R)-2-[(3S,3aS,5R,8R,8aS)-8,8a-dihydroxy-3,8-dimethyl-1,2,3,3a,4,5,6,7-octahydroazulen-5-yl]-2-hydroxypropyl] hydrogen sulfate |
| SMILES | C[C@H]1CC[C@]2(O)[C@H]1C[C@H]([C@@](C)(O)COS(=O)(=O)O)CC[C@@]2(C)O |
| InChI | InChI=1S/C15H28O7S/c1-10-4-7-15(18)12(10)8-11(5-6-14(15,3)17)13(2,16)9-22-23(19,20)21/h10-12,16-18H,4-9H2,1-3H3,(H,19,20,21)/t10-,11+,12-,13-,14+,15-/m0/s1 |
| InChIKey | WGZJGSMZQTWTSO-HGPDSQILSA-N |
| XLogP | 0.89 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|