C25H36O7 — CID 163037209
[(3aR,4R,5E,7R,9E,11aS)-7-hydroxy-10-methyl-4-(3-methylbutanoyloxy)-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-6-yl]methyl 3-methylbutanoate (PubChem CID 163037209) has the molecular formula C25H36O7 and a molecular weight of 448.56 g/mol. Its IUPAC name is [(3aR,4R,5E,7R,9E,11aS)-7-hydroxy-10-methyl-4-(3-methylbutanoyloxy)-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-6-yl]methyl 3-methylbutanoate.
| Compound Name | [(3aR,4R,5E,7R,9E,11aS)-7-hydroxy-10-methyl-4-(3-methylbutanoyloxy)-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-6-yl]methyl 3-methylbutanoate |
|---|---|
| PubChem CID | 163037209 |
| Molecular Formula | C25H36O7 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | [(3aR,4R,5E,7R,9E,11aS)-7-hydroxy-10-methyl-4-(3-methylbutanoyloxy)-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-6-yl]methyl 3-methylbutanoate |
| SMILES | C=C1C(=O)O[C@H]2C/C(C)=C/C[C@@H](O)/C(COC(=O)CC(C)C)=C/[C@@H](OC(=O)CC(C)C)[C@H]12 |
| InChI | InChI=1S/C25H36O7/c1-14(2)9-22(27)30-13-18-12-21(31-23(28)10-15(3)4)24-17(6)25(29)32-20(24)11-16(5)7-8-19(18)26/h7,12,14-15,19-21,24,26H,6,8-11,13H2,1-5H3/b16-7+,18-12+/t19-,20+,21-,24-/m1/s1 |
| InChIKey | HDHMEDUJVRZJJV-CQJVZMHGSA-N |
| XLogP | 3.66 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|