C23H24O11 — CID 163038122
[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-[(9R)-1,4,5-trihydroxy-7-(hydroxymethyl)-10-oxo-9H-anthracen-9-yl]oxan-2-yl]methyl acetate (PubChem CID 163038122) has the molecular formula C23H24O11 and a molecular weight of 476.43 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-[(9R)-1,4,5-trihydroxy-7-(hydroxymethyl)-10-oxo-9H-anthracen-9-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-[(9R)-1,4,5-trihydroxy-7-(hydroxymethyl)-10-oxo-9H-anthracen-9-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 163038122 |
| Molecular Formula | C23H24O11 |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-[(9R)-1,4,5-trihydroxy-7-(hydroxymethyl)-10-oxo-9H-anthracen-9-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H]([C@@H]2c3cc(CO)cc(O)c3C(=O)c3c(O)ccc(O)c32)C(O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C23H24O11/c1-8(25)33-7-14-19(29)21(31)22(32)23(34-14)16-10-4-9(6-24)5-13(28)15(10)20(30)18-12(27)3-2-11(26)17(16)18/h2-5,14,16,19,21-24,26-29,31-32H,6-7H2,1H3/t14-,16-,19+,21+,22?,23+/m1/s1 |
| InChIKey | YNTRKVVINRSNHR-RTMZNAFSSA-N |
| XLogP | -0.61 |
| TPSA | 194.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|