C25H26O12 — CID 46844574
[(2R,3S,4S,5R,6S)-5-acetyloxy-3,4-dihydroxy-6-[(9R)-1,4,5-trihydroxy-7-(hydroxymethyl)-10-oxo-9H-anthracen-9-yl]oxan-2-yl]methyl acetate (PubChem CID 46844574) has the molecular formula C25H26O12 and a molecular weight of 518.47 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-5-acetyloxy-3,4-dihydroxy-6-[(9R)-1,4,5-trihydroxy-7-(hydroxymethyl)-10-oxo-9H-anthracen-9-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-5-acetyloxy-3,4-dihydroxy-6-[(9R)-1,4,5-trihydroxy-7-(hydroxymethyl)-10-oxo-9H-anthracen-9-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 46844574 |
| Molecular Formula | C25H26O12 |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-5-acetyloxy-3,4-dihydroxy-6-[(9R)-1,4,5-trihydroxy-7-(hydroxymethyl)-10-oxo-9H-anthracen-9-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H]([C@@H]2c3cc(CO)cc(O)c3C(=O)c3c(O)ccc(O)c32)C(OC(C)=O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H26O12/c1-9(27)35-8-16-21(32)23(34)25(36-10(2)28)24(37-16)18-12-5-11(7-26)6-15(31)17(12)22(33)20-14(30)4-3-13(29)19(18)20/h3-6,16,18,21,23-26,29-32,34H,7-8H2,1-2H3/t16-,18-,21-,23+,24+,25?/m1/s1 |
| InChIKey | LCGFTZURIZOVSV-FHTIUITESA-N |
| XLogP | -0.04 |
| TPSA | 200.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|