C15H20O — CID 163039256
(6R,7E,13E)-pentadeca-7,13-dien-9,11-diyn-6-ol (PubChem CID 163039256) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is (6R,7E,13E)-pentadeca-7,13-dien-9,11-diyn-6-ol.
| Compound Name | (6R,7E,13E)-pentadeca-7,13-dien-9,11-diyn-6-ol |
|---|---|
| PubChem CID | 163039256 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (6R,7E,13E)-pentadeca-7,13-dien-9,11-diyn-6-ol |
| SMILES | C/C=C/C#CC#C/C=C/[C@H](O)CCCCC |
| InChI | InChI=1S/C15H20O/c1-3-5-7-8-9-10-12-14-15(16)13-11-6-4-2/h3,5,12,14-16H,4,6,11,13H2,1-2H3/b5-3+,14-12+/t15-/m1/s1 |
| InChIKey | XAXGSDODPMRMAE-MGFOOGNRSA-N |
| XLogP | 3.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|