C19H20N2O — CID 163039766
(1R,14E)-14-ethylidene-16-methyl-17-methylidene-9,16-diazatetracyclo[11.3.1.02,10.03,8]heptadeca-2(10),3,5,7-tetraen-11-one (PubChem CID 163039766) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is (1R,14E)-14-ethylidene-16-methyl-17-methylidene-9,16-diazatetracyclo[11.3.1.02,10.03,8]heptadeca-2(10),3,5,7-tetraen-11-one.
| Compound Name | (1R,14E)-14-ethylidene-16-methyl-17-methylidene-9,16-diazatetracyclo[11.3.1.02,10.03,8]heptadeca-2(10),3,5,7-tetraen-11-one |
|---|---|
| PubChem CID | 163039766 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | (1R,14E)-14-ethylidene-16-methyl-17-methylidene-9,16-diazatetracyclo[11.3.1.02,10.03,8]heptadeca-2(10),3,5,7-tetraen-11-one |
| SMILES | C=C1C2CC(=O)c3[nH]c4ccccc4c3[C@@H]1N(C)C/C2=C/C |
| InChI | InChI=1S/C19H20N2O/c1-4-12-10-21(3)19-11(2)14(12)9-16(22)18-17(19)13-7-5-6-8-15(13)20-18/h4-8,14,19-20H,2,9-10H2,1,3H3/b12-4-/t14?,19-/m1/s1 |
| InChIKey | IIVNFAVESMLIIL-VFZMZAQLSA-N |
| XLogP | 3.86 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|