C18H18N2O — CID 11471452
(1S,12S,14S,15Z)-15-ethylidene-3,17-diazapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4,6,8-tetraen-13-one (PubChem CID 11471452) has the molecular formula C18H18N2O and a molecular weight of 278.35 g/mol. Its IUPAC name is (1S,12S,14S,15Z)-15-ethylidene-3,17-diazapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4,6,8-tetraen-13-one.
| Compound Name | (1S,12S,14S,15Z)-15-ethylidene-3,17-diazapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4,6,8-tetraen-13-one |
|---|---|
| PubChem CID | 11471452 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (1S,12S,14S,15Z)-15-ethylidene-3,17-diazapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4,6,8-tetraen-13-one |
| SMILES | C/C=C1\CN2[C@H]3Cc4c([nH]c5ccccc45)[C@@H]2C[C@@H]1C3=O |
| InChI | InChI=1S/C18H18N2O/c1-2-10-9-20-15-7-12(10)18(21)16(20)8-13-11-5-3-4-6-14(11)19-17(13)15/h2-6,12,15-16,19H,7-9H2,1H3/b10-2+/t12-,15-,16-/m0/s1 |
| InChIKey | VQAOGTKYFIIYOC-UKMCEADRSA-N |
| XLogP | 2.98 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|