C19H20N2O2 — CID 135004546
(1S,12S,15E)-15-ethylidene-6-methoxy-3,17-diazapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4(9),5,7-tetraen-13-one (PubChem CID 135004546) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is (1S,12S,15E)-15-ethylidene-6-methoxy-3,17-diazapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4(9),5,7-tetraen-13-one.
| Compound Name | (1S,12S,15E)-15-ethylidene-6-methoxy-3,17-diazapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4(9),5,7-tetraen-13-one |
|---|---|
| PubChem CID | 135004546 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (1S,12S,15E)-15-ethylidene-6-methoxy-3,17-diazapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4(9),5,7-tetraen-13-one |
| SMILES | C/C=C1/CN2[C@H]3Cc4c([nH]c5cc(OC)ccc45)[C@@H]2CC1C3=O |
| InChI | InChI=1S/C19H20N2O2/c1-3-10-9-21-16-7-13(10)19(22)17(21)8-14-12-5-4-11(23-2)6-15(12)20-18(14)16/h3-6,13,16-17,20H,7-9H2,1-2H3/b10-3-/t13?,16-,17-/m0/s1 |
| InChIKey | VHWGWCUPMLGBBQ-HIJZBUJMSA-N |
| XLogP | 2.99 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|