C20H22N2O — CID 11370226
(1S,12S,14R,15E)-15-ethylidene-6-methoxy-13-methylidene-3,17-diazapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4(9),5,7-tetraene (PubChem CID 11370226) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is (1S,12S,14R,15E)-15-ethylidene-6-methoxy-13-methylidene-3,17-diazapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4(9),5,7-tetraene.
| Compound Name | (1S,12S,14R,15E)-15-ethylidene-6-methoxy-13-methylidene-3,17-diazapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4(9),5,7-tetraene |
|---|---|
| PubChem CID | 11370226 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (1S,12S,14R,15E)-15-ethylidene-6-methoxy-13-methylidene-3,17-diazapentacyclo[12.3.1.02,10.04,9.012,17]octadeca-2(10),4(9),5,7-tetraene |
| SMILES | C=C1[C@@H]2C[C@H]3c4[nH]c5cc(OC)ccc5c4C[C@@H]1N3C/C2=C/C |
| InChI | InChI=1S/C20H22N2O/c1-4-12-10-22-18-9-16-14-6-5-13(23-3)7-17(14)21-20(16)19(22)8-15(12)11(18)2/h4-7,15,18-19,21H,2,8-10H2,1,3H3/b12-4-/t15-,18-,19-/m0/s1 |
| InChIKey | JBSOUNASMNDTGC-QBXFZIGBSA-N |
| XLogP | 3.98 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|