C21H30O4 — CID 163039801
methyl 7-ethenyl-1-formyl-8a-hydroxy-4a,7-dimethyl-4,4b,5,6,8,9,10,10a-octahydro-3H-phenanthrene-2-carboxylate (PubChem CID 163039801) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is methyl 7-ethenyl-1-formyl-8a-hydroxy-4a,7-dimethyl-4,4b,5,6,8,9,10,10a-octahydro-3H-phenanthrene-2-carboxylate.
| Compound Name | methyl 7-ethenyl-1-formyl-8a-hydroxy-4a,7-dimethyl-4,4b,5,6,8,9,10,10a-octahydro-3H-phenanthrene-2-carboxylate |
|---|---|
| PubChem CID | 163039801 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | methyl 7-ethenyl-1-formyl-8a-hydroxy-4a,7-dimethyl-4,4b,5,6,8,9,10,10a-octahydro-3H-phenanthrene-2-carboxylate |
| SMILES | C=CC1(C)CCC2C(O)(CCC3C(C=O)=C(C(=O)OC)CCC32C)C1 |
| InChI | InChI=1S/C21H30O4/c1-5-19(2)9-8-17-20(3)10-6-14(18(23)25-4)15(12-22)16(20)7-11-21(17,24)13-19/h5,12,16-17,24H,1,6-11,13H2,2-4H3 |
| InChIKey | STSSIXLXPNXXKZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|