C37H48N2O9 — CID 163040152
(3-ethyl-8,12,14,17-tetramethoxy-16-oxo-3-azahexacyclo[7.6.3.110,13.01,11.02,9.05,18]nonadecan-5-yl)methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 163040152) has the molecular formula C37H48N2O9 and a molecular weight of 664.80 g/mol. Its IUPAC name is (3-ethyl-8,12,14,17-tetramethoxy-16-oxo-3-azahexacyclo[7.6.3.110,13.01,11.02,9.05,18]nonadecan-5-yl)methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | (3-ethyl-8,12,14,17-tetramethoxy-16-oxo-3-azahexacyclo[7.6.3.110,13.01,11.02,9.05,18]nonadecan-5-yl)methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 163040152 |
| Molecular Formula | C37H48N2O9 |
| Molecular Weight | 664.80 g/mol |
| Exact Mass | 664.34 |
| IUPAC Name | (3-ethyl-8,12,14,17-tetramethoxy-16-oxo-3-azahexacyclo[7.6.3.110,13.01,11.02,9.05,18]nonadecan-5-yl)methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | CCN1CC2(COC(=O)c3ccccc3N3C(=O)CC(C)C3=O)CCC(OC)C34C5CC6C(OC)CC(C(=O)C(OC)C23)(C5C6OC)C14 |
| InChI | InChI=1S/C37H48N2O9/c1-7-38-17-35(18-48-33(43)20-10-8-9-11-23(20)39-26(40)14-19(2)32(39)42)13-12-25(45-4)37-22-15-21-24(44-3)16-36(34(37)38,27(22)28(21)46-5)31(41)29(47-6)30(35)37/h8-11,19,21-22,24-25,27-30,34H,7,12-18H2,1-6H3 |
| InChIKey | MQOIQKHNDYFUQO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 120.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.80 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|