C41H56N2O11 — CID 163087563
(8-ethoxy-11-ethyl-9-hydroxy-6,16,18-trimethoxy-4-propanoyloxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-13-yl)methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 163087563) has the molecular formula C41H56N2O11 and a molecular weight of 752.90 g/mol. Its IUPAC name is (8-ethoxy-11-ethyl-9-hydroxy-6,16,18-trimethoxy-4-propanoyloxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-13-yl)methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | (8-ethoxy-11-ethyl-9-hydroxy-6,16,18-trimethoxy-4-propanoyloxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-13-yl)methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 163087563 |
| Molecular Formula | C41H56N2O11 |
| Molecular Weight | 752.90 g/mol |
| Exact Mass | 752.39 |
| IUPAC Name | (8-ethoxy-11-ethyl-9-hydroxy-6,16,18-trimethoxy-4-propanoyloxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-13-yl)methyl 2-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | CCOC12CC(OC)C3CC(C1C3OC(=O)CC)C13C(OC)CCC4(COC(=O)c5ccccc5N5C(=O)CC(C)C5=O)CN(CC)C1C2(O)C(OC)C43 |
| InChI | InChI=1S/C41H56N2O11/c1-8-30(45)54-32-24-18-25-31(32)39(53-10-3,19-27(24)49-5)41(48)34(51-7)33-38(16-15-28(50-6)40(25,33)37(41)42(9-2)20-38)21-52-36(47)23-13-11-12-14-26(23)43-29(44)17-22(4)35(43)46/h11-14,22,24-25,27-28,31-34,37,48H,8-10,15-21H2,1-7H3 |
| InChIKey | ZBCYJHCFJNSGND-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 150.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.90 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|