C10H16N2O2 — CID 163040484
N-(2-aminoacetyl)-2-[(1R)-cyclohex-2-en-1-yl]acetamide (PubChem CID 163040484) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is N-(2-aminoacetyl)-2-[(1R)-cyclohex-2-en-1-yl]acetamide.
| Compound Name | N-(2-aminoacetyl)-2-[(1R)-cyclohex-2-en-1-yl]acetamide |
|---|---|
| PubChem CID | 163040484 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | N-(2-aminoacetyl)-2-[(1R)-cyclohex-2-en-1-yl]acetamide |
| SMILES | NCC(=O)NC(=O)C[C@@H]1C=CCCC1 |
| InChI | InChI=1S/C10H16N2O2/c11-7-10(14)12-9(13)6-8-4-2-1-3-5-8/h2,4,8H,1,3,5-7,11H2,(H,12,13,14)/t8-/m1/s1 |
| InChIKey | VHMMMWQOFNHXOS-MRVPVSSYSA-N |
| XLogP | 0.33 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|