C30H46O5 — CID 163040918
[(3S,5S,8S,10S,13S,14S,17S)-17-[(2S,5R)-2-hydroxy-5,6-dimethyl-4-oxoheptan-2-yl]-10,13-dimethyl-6-oxo-1,2,3,4,5,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 163040918) has the molecular formula C30H46O5 and a molecular weight of 486.69 g/mol. Its IUPAC name is [(3S,5S,8S,10S,13S,14S,17S)-17-[(2S,5R)-2-hydroxy-5,6-dimethyl-4-oxoheptan-2-yl]-10,13-dimethyl-6-oxo-1,2,3,4,5,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,5S,8S,10S,13S,14S,17S)-17-[(2S,5R)-2-hydroxy-5,6-dimethyl-4-oxoheptan-2-yl]-10,13-dimethyl-6-oxo-1,2,3,4,5,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 163040918 |
| Molecular Formula | C30H46O5 |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | [(3S,5S,8S,10S,13S,14S,17S)-17-[(2S,5R)-2-hydroxy-5,6-dimethyl-4-oxoheptan-2-yl]-10,13-dimethyl-6-oxo-1,2,3,4,5,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@]2(C)C3=CC[C@@]4(C)[C@@H](CC[C@@H]4[C@@](C)(O)CC(=O)[C@H](C)C(C)C)[C@@H]3CC(=O)[C@H]2C1 |
| InChI | InChI=1S/C30H46O5/c1-17(2)18(3)26(33)16-30(7,34)27-9-8-22-21-15-25(32)24-14-20(35-19(4)31)10-12-28(24,5)23(21)11-13-29(22,27)6/h11,17-18,20-22,24,27,34H,8-10,12-16H2,1-7H3/t18-,20+,21+,22+,24-,27+,28-,29+,30+/m1/s1 |
| InChIKey | ZIVAESIIIQMIHN-IUJJUXBXSA-N |
| XLogP | 5.68 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|