C14H18O3 — CID 163041280
(E,2R)-9-(2-methylbut-3-en-2-yloxy)non-7-en-3,5-diyne-1,2-diol (PubChem CID 163041280) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (E,2R)-9-(2-methylbut-3-en-2-yloxy)non-7-en-3,5-diyne-1,2-diol.
| Compound Name | (E,2R)-9-(2-methylbut-3-en-2-yloxy)non-7-en-3,5-diyne-1,2-diol |
|---|---|
| PubChem CID | 163041280 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (E,2R)-9-(2-methylbut-3-en-2-yloxy)non-7-en-3,5-diyne-1,2-diol |
| SMILES | C=CC(C)(C)OC/C=C/C#CC#C[C@@H](O)CO |
| InChI | InChI=1S/C14H18O3/c1-4-14(2,3)17-11-9-7-5-6-8-10-13(16)12-15/h4,7,9,13,15-16H,1,11-12H2,2-3H3/b9-7+/t13-/m1/s1 |
| InChIKey | ZDRAVVZFZYIQOC-BUUCAEBMSA-N |
| XLogP | 0.88 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|