C22H24N2O4 — CID 163042620
[(1R,10S,12R,13E,14R,16S,17S,18R)-13-ethylidene-14-hydroxy-4-methoxy-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2(7),3,5,8-tetraen-18-yl] acetate (PubChem CID 163042620) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is [(1R,10S,12R,13E,14R,16S,17S,18R)-13-ethylidene-14-hydroxy-4-methoxy-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2(7),3,5,8-tetraen-18-yl] acetate.
| Compound Name | [(1R,10S,12R,13E,14R,16S,17S,18R)-13-ethylidene-14-hydroxy-4-methoxy-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2(7),3,5,8-tetraen-18-yl] acetate |
|---|---|
| PubChem CID | 163042620 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | [(1R,10S,12R,13E,14R,16S,17S,18R)-13-ethylidene-14-hydroxy-4-methoxy-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2(7),3,5,8-tetraen-18-yl] acetate |
| SMILES | C/C=C1/[C@@H](O)N2[C@H]3C[C@@H]1[C@@H]1[C@@H](OC(C)=O)[C@@]4(C[C@@H]12)C3=Nc1ccc(OC)cc14 |
| InChI | InChI=1S/C22H24N2O4/c1-4-12-13-8-16-19-22(14-7-11(27-3)5-6-15(14)23-19)9-17(24(16)21(12)26)18(13)20(22)28-10(2)25/h4-7,13,16-18,20-21,26H,8-9H2,1-3H3/b12-4+/t13-,16-,17-,18-,20+,21+,22+/m0/s1 |
| InChIKey | DCLQJGLKBIQNJC-GAVAQRGESA-N |
| XLogP | 2.32 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|