C13H22O2 — CID 163043628
[(4S)-3,3,6-trimethylhepta-1,5-dien-4-yl] propanoate (PubChem CID 163043628) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is [(4S)-3,3,6-trimethylhepta-1,5-dien-4-yl] propanoate.
| Compound Name | [(4S)-3,3,6-trimethylhepta-1,5-dien-4-yl] propanoate |
|---|---|
| PubChem CID | 163043628 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | [(4S)-3,3,6-trimethylhepta-1,5-dien-4-yl] propanoate |
| SMILES | C=CC(C)(C)[C@H](C=C(C)C)OC(=O)CC |
| InChI | InChI=1S/C13H22O2/c1-7-12(14)15-11(9-10(3)4)13(5,6)8-2/h8-9,11H,2,7H2,1,3-6H3/t11-/m0/s1 |
| InChIKey | OTRUQIDANLIZDL-NSHDSACASA-N |
| XLogP | 3.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|