C21H26O8 — CID 163044060
methyl (1R,2S,6R,7R,9S)-7-[(2S)-2-hydroxy-2-methylbut-3-enoyl]oxy-9-methyl-5-methylidene-4-oxo-3,14-dioxatricyclo[7.4.1.02,6]tetradec-12-ene-13-carboxylate (PubChem CID 163044060) has the molecular formula C21H26O8 and a molecular weight of 406.43 g/mol. Its IUPAC name is methyl (1R,2S,6R,7R,9S)-7-[(2S)-2-hydroxy-2-methylbut-3-enoyl]oxy-9-methyl-5-methylidene-4-oxo-3,14-dioxatricyclo[7.4.1.02,6]tetradec-12-ene-13-carboxylate.
| Compound Name | methyl (1R,2S,6R,7R,9S)-7-[(2S)-2-hydroxy-2-methylbut-3-enoyl]oxy-9-methyl-5-methylidene-4-oxo-3,14-dioxatricyclo[7.4.1.02,6]tetradec-12-ene-13-carboxylate |
|---|---|
| PubChem CID | 163044060 |
| Molecular Formula | C21H26O8 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | methyl (1R,2S,6R,7R,9S)-7-[(2S)-2-hydroxy-2-methylbut-3-enoyl]oxy-9-methyl-5-methylidene-4-oxo-3,14-dioxatricyclo[7.4.1.02,6]tetradec-12-ene-13-carboxylate |
| SMILES | C=C[C@](C)(O)C(=O)O[C@@H]1C[C@]2(C)CCC=C(C(=O)OC)[C@@H](O2)[C@H]2OC(=O)C(=C)[C@@H]21 |
| InChI | InChI=1S/C21H26O8/c1-6-21(4,25)19(24)27-13-10-20(3)9-7-8-12(18(23)26-5)15(29-20)16-14(13)11(2)17(22)28-16/h6,8,13-16,25H,1-2,7,9-10H2,3-5H3/t13-,14-,15-,16+,20+,21+/m1/s1 |
| InChIKey | MIZWRTJIIRMVJE-CGZTVDABSA-N |
| XLogP | 1.37 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|