C21H26O9 — CID 163036733
methyl 11-hydroperoxy-5-hydroxy-4-(2-methylbut-2-enoyloxy)-3,10-dimethylidene-2-oxo-4,5,8,9,11,11a-hexahydro-3aH-cyclodeca[b]furan-6-carboxylate (PubChem CID 163036733) has the molecular formula C21H26O9 and a molecular weight of 422.43 g/mol. Its IUPAC name is methyl 11-hydroperoxy-5-hydroxy-4-(2-methylbut-2-enoyloxy)-3,10-dimethylidene-2-oxo-4,5,8,9,11,11a-hexahydro-3aH-cyclodeca[b]furan-6-carboxylate.
| Compound Name | methyl 11-hydroperoxy-5-hydroxy-4-(2-methylbut-2-enoyloxy)-3,10-dimethylidene-2-oxo-4,5,8,9,11,11a-hexahydro-3aH-cyclodeca[b]furan-6-carboxylate |
|---|---|
| PubChem CID | 163036733 |
| Molecular Formula | C21H26O9 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | methyl 11-hydroperoxy-5-hydroxy-4-(2-methylbut-2-enoyloxy)-3,10-dimethylidene-2-oxo-4,5,8,9,11,11a-hexahydro-3aH-cyclodeca[b]furan-6-carboxylate |
| SMILES | C=C1CCC=C(C(=O)OC)C(O)C(OC(=O)C(C)=CC)C2C(=C)C(=O)OC2C1OO |
| InChI | InChI=1S/C21H26O9/c1-6-10(2)19(23)28-17-14-12(4)20(24)29-18(14)16(30-26)11(3)8-7-9-13(15(17)22)21(25)27-5/h6,9,14-18,22,26H,3-4,7-8H2,1-2,5H3 |
| InChIKey | GEAVRACREUWZDP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|