C25H32O10 — CID 177398347
methyl (3aS,4S,6E,11S,11aS)-11-hydroxy-5-[(Z)-2-(hydroxymethyl)but-2-enoyl]oxy-3,10-dimethylidene-4-(2-methylpropanoyloxy)-2-oxo-4,5,8,9,11,11a-hexahydro-3aH-cyclodeca[b]furan-6-carboxylate (PubChem CID 177398347) has the molecular formula C25H32O10 and a molecular weight of 492.52 g/mol. Its IUPAC name is methyl (3aS,4S,6E,11S,11aS)-11-hydroxy-5-[(Z)-2-(hydroxymethyl)but-2-enoyl]oxy-3,10-dimethylidene-4-(2-methylpropanoyloxy)-2-oxo-4,5,8,9,11,11a-hexahydro-3aH-cyclodeca[b]furan-6-carboxylate.
| Compound Name | methyl (3aS,4S,6E,11S,11aS)-11-hydroxy-5-[(Z)-2-(hydroxymethyl)but-2-enoyl]oxy-3,10-dimethylidene-4-(2-methylpropanoyloxy)-2-oxo-4,5,8,9,11,11a-hexahydro-3aH-cyclodeca[b]furan-6-carboxylate |
|---|---|
| PubChem CID | 177398347 |
| Molecular Formula | C25H32O10 |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | methyl (3aS,4S,6E,11S,11aS)-11-hydroxy-5-[(Z)-2-(hydroxymethyl)but-2-enoyl]oxy-3,10-dimethylidene-4-(2-methylpropanoyloxy)-2-oxo-4,5,8,9,11,11a-hexahydro-3aH-cyclodeca[b]furan-6-carboxylate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1[C@H](OC(=O)C(C)C)C(OC(=O)/C(=C\C)CO)/C(C(=O)OC)=C\CCC(=C)[C@@H]2O |
| InChI | InChI=1S/C25H32O10/c1-7-15(11-26)24(30)33-19-16(25(31)32-6)10-8-9-13(4)18(27)20-17(14(5)23(29)34-20)21(19)35-22(28)12(2)3/h7,10,12,17-21,26-27H,4-5,8-9,11H2,1-3,6H3/b15-7-,16-10+/t17-,18-,19?,20-,21-/m0/s1 |
| InChIKey | XMUNLUYNEDVGGM-HTFHLAQYSA-N |
| XLogP | 1.31 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|