C26H34O10 — CID 162852215
methyl 11-hydroxy-5-[2-(hydroxymethyl)but-2-enoyloxy]-4-(2-methylbutanoyloxy)-3,10-dimethylidene-2-oxo-4,5,8,9,11,11a-hexahydro-3aH-cyclodeca[b]furan-6-carboxylate (PubChem CID 162852215) has the molecular formula C26H34O10 and a molecular weight of 506.55 g/mol. Its IUPAC name is methyl 11-hydroxy-5-[2-(hydroxymethyl)but-2-enoyloxy]-4-(2-methylbutanoyloxy)-3,10-dimethylidene-2-oxo-4,5,8,9,11,11a-hexahydro-3aH-cyclodeca[b]furan-6-carboxylate.
| Compound Name | methyl 11-hydroxy-5-[2-(hydroxymethyl)but-2-enoyloxy]-4-(2-methylbutanoyloxy)-3,10-dimethylidene-2-oxo-4,5,8,9,11,11a-hexahydro-3aH-cyclodeca[b]furan-6-carboxylate |
|---|---|
| PubChem CID | 162852215 |
| Molecular Formula | C26H34O10 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | methyl 11-hydroxy-5-[2-(hydroxymethyl)but-2-enoyloxy]-4-(2-methylbutanoyloxy)-3,10-dimethylidene-2-oxo-4,5,8,9,11,11a-hexahydro-3aH-cyclodeca[b]furan-6-carboxylate |
| SMILES | C=C1CCC=C(C(=O)OC)C(OC(=O)C(=CC)CO)C(OC(=O)C(C)CC)C2C(=C)C(=O)OC2C1O |
| InChI | InChI=1S/C26H34O10/c1-7-13(3)23(29)36-22-18-15(5)24(30)35-21(18)19(28)14(4)10-9-11-17(26(32)33-6)20(22)34-25(31)16(8-2)12-27/h8,11,13,18-22,27-28H,4-5,7,9-10,12H2,1-3,6H3 |
| InChIKey | IVQFRPZHDFKKNP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|