C10H19NO2 — CID 163044166
(E,4R)-4-hydroxy-N-(2-methylpropyl)hex-2-enamide (PubChem CID 163044166) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is (E,4R)-4-hydroxy-N-(2-methylpropyl)hex-2-enamide.
| Compound Name | (E,4R)-4-hydroxy-N-(2-methylpropyl)hex-2-enamide |
|---|---|
| PubChem CID | 163044166 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (E,4R)-4-hydroxy-N-(2-methylpropyl)hex-2-enamide |
| SMILES | CC[C@@H](O)/C=C/C(=O)NCC(C)C |
| InChI | InChI=1S/C10H19NO2/c1-4-9(12)5-6-10(13)11-7-8(2)3/h5-6,8-9,12H,4,7H2,1-3H3,(H,11,13)/b6-5+/t9-/m1/s1 |
| InChIKey | CHVSACQEPFATBT-VUHVRTRXSA-N |
| XLogP | 1.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|