C25H29N3O3 — CID 163046377
(7R,8R,13R)-8-hydroxy-7-phenyl-1,6,10-triazatricyclo[11.9.0.014,19]docosa-14,16,18,20-tetraene-9,22-dione (PubChem CID 163046377) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is (7R,8R,13R)-8-hydroxy-7-phenyl-1,6,10-triazatricyclo[11.9.0.014,19]docosa-14,16,18,20-tetraene-9,22-dione.
| Compound Name | (7R,8R,13R)-8-hydroxy-7-phenyl-1,6,10-triazatricyclo[11.9.0.014,19]docosa-14,16,18,20-tetraene-9,22-dione |
|---|---|
| PubChem CID | 163046377 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | (7R,8R,13R)-8-hydroxy-7-phenyl-1,6,10-triazatricyclo[11.9.0.014,19]docosa-14,16,18,20-tetraene-9,22-dione |
| SMILES | O=C1NCC[C@@H]2c3ccccc3C=CC(=O)N2CCCCN[C@H](c2ccccc2)[C@H]1O |
| InChI | InChI=1S/C25H29N3O3/c29-22-13-12-18-8-4-5-11-20(18)21-14-16-27-25(31)24(30)23(19-9-2-1-3-10-19)26-15-6-7-17-28(21)22/h1-5,8-13,21,23-24,26,30H,6-7,14-17H2,(H,27,31)/t21-,23-,24-/m1/s1 |
| InChIKey | SIQVIAKJJUTAEQ-GMKZXUHWSA-N |
| XLogP | 2.58 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |