C18H26O3 — CID 163046820
(3Z,5R)-3-[(E)-4-methyl-8-oxonon-4-enylidene]-5-(2-methylprop-1-enyl)oxolan-2-one (PubChem CID 163046820) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (3Z,5R)-3-[(E)-4-methyl-8-oxonon-4-enylidene]-5-(2-methylprop-1-enyl)oxolan-2-one.
| Compound Name | (3Z,5R)-3-[(E)-4-methyl-8-oxonon-4-enylidene]-5-(2-methylprop-1-enyl)oxolan-2-one |
|---|---|
| PubChem CID | 163046820 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (3Z,5R)-3-[(E)-4-methyl-8-oxonon-4-enylidene]-5-(2-methylprop-1-enyl)oxolan-2-one |
| SMILES | CC(=O)CC/C=C(\C)CC/C=C1/C[C@H](C=C(C)C)OC1=O |
| InChI | InChI=1S/C18H26O3/c1-13(2)11-17-12-16(18(20)21-17)10-6-8-14(3)7-5-9-15(4)19/h7,10-11,17H,5-6,8-9,12H2,1-4H3/b14-7+,16-10-/t17-/m0/s1 |
| InChIKey | FWVXVXHMEPTOAS-AVCXMOTFSA-N |
| XLogP | 4.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|