C18H28O7 — CID 163048264
[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[[(1R,5S,6R)-2,7,7-trimethyl-6-bicyclo[3.1.1]hept-2-enyl]oxy]oxan-3-yl] acetate (PubChem CID 163048264) has the molecular formula C18H28O7 and a molecular weight of 356.42 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[[(1R,5S,6R)-2,7,7-trimethyl-6-bicyclo[3.1.1]hept-2-enyl]oxy]oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[[(1R,5S,6R)-2,7,7-trimethyl-6-bicyclo[3.1.1]hept-2-enyl]oxy]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 163048264 |
| Molecular Formula | C18H28O7 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[[(1R,5S,6R)-2,7,7-trimethyl-6-bicyclo[3.1.1]hept-2-enyl]oxy]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](O[C@@H]2[C@H]3CC=C(C)[C@@H]2C3(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H28O7/c1-8-5-6-10-15(12(8)18(10,3)4)25-17-16(23-9(2)20)14(22)13(21)11(7-19)24-17/h5,10-17,19,21-22H,6-7H2,1-4H3/t10-,11-,12+,13-,14+,15-,16-,17+/m1/s1 |
| InChIKey | RVMGGXLVAQJVDV-YIHXMNRVSA-N |
| XLogP | 0.36 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|