C16H24O4 — CID 163048556
methyl 2-[(1R,4R)-4-methyl-3-oxo-4-(4-oxopentyl)cyclohexyl]prop-2-enoate (PubChem CID 163048556) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is methyl 2-[(1R,4R)-4-methyl-3-oxo-4-(4-oxopentyl)cyclohexyl]prop-2-enoate.
| Compound Name | methyl 2-[(1R,4R)-4-methyl-3-oxo-4-(4-oxopentyl)cyclohexyl]prop-2-enoate |
|---|---|
| PubChem CID | 163048556 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | methyl 2-[(1R,4R)-4-methyl-3-oxo-4-(4-oxopentyl)cyclohexyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CC[C@@](C)(CCCC(C)=O)C(=O)C1 |
| InChI | InChI=1S/C16H24O4/c1-11(17)6-5-8-16(3)9-7-13(10-14(16)18)12(2)15(19)20-4/h13H,2,5-10H2,1,3-4H3/t13-,16-/m1/s1 |
| InChIKey | ZLKNYJMXLQBGLL-CZUORRHYSA-N |
| XLogP | 2.85 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|