C22H30O4 — CID 163048861
(6R,7R)-7-hydroxy-7-methyl-6-(2-oxononyl)-3-[(E)-prop-1-enyl]-6H-isochromen-8-one (PubChem CID 163048861) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is (6R,7R)-7-hydroxy-7-methyl-6-(2-oxononyl)-3-[(E)-prop-1-enyl]-6H-isochromen-8-one.
| Compound Name | (6R,7R)-7-hydroxy-7-methyl-6-(2-oxononyl)-3-[(E)-prop-1-enyl]-6H-isochromen-8-one |
|---|---|
| PubChem CID | 163048861 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (6R,7R)-7-hydroxy-7-methyl-6-(2-oxononyl)-3-[(E)-prop-1-enyl]-6H-isochromen-8-one |
| SMILES | C/C=C/C1=CC2=C[C@@H](CC(=O)CCCCCCC)[C@@](C)(O)C(=O)C2=CO1 |
| InChI | InChI=1S/C22H30O4/c1-4-6-7-8-9-11-18(23)14-17-12-16-13-19(10-5-2)26-15-20(16)21(24)22(17,3)25/h5,10,12-13,15,17,25H,4,6-9,11,14H2,1-3H3/b10-5+/t17-,22+/m0/s1 |
| InChIKey | RUCZLGHAFWWKOE-YDZKVNNASA-N |
| XLogP | 4.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|