C15H18O4 — CID 5275546
5-hydroxy-3,8-dimethyl-5-propan-2-yl-7,8-dihydronaphthalene-1,2,6-trione (PubChem CID 5275546) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is 5-hydroxy-3,8-dimethyl-5-propan-2-yl-7,8-dihydronaphthalene-1,2,6-trione.
| Compound Name | 5-hydroxy-3,8-dimethyl-5-propan-2-yl-7,8-dihydronaphthalene-1,2,6-trione |
|---|---|
| PubChem CID | 5275546 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 5-hydroxy-3,8-dimethyl-5-propan-2-yl-7,8-dihydronaphthalene-1,2,6-trione |
| SMILES | CC1=CC2=C(C(=O)C1=O)C(C)CC(=O)C2(O)C(C)C |
| InChI | InChI=1S/C15H18O4/c1-7(2)15(19)10-5-9(4)13(17)14(18)12(10)8(3)6-11(15)16/h5,7-8,19H,6H2,1-4H3 |
| InChIKey | DUXDMFCFEMJGKL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|