C20H26O4 — CID 163193292
(6S,7R)-7-hydroxy-7-methyl-6-(2-oxoheptyl)-3-[(E)-prop-1-enyl]-6H-isochromen-8-one (PubChem CID 163193292) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (6S,7R)-7-hydroxy-7-methyl-6-(2-oxoheptyl)-3-[(E)-prop-1-enyl]-6H-isochromen-8-one.
| Compound Name | (6S,7R)-7-hydroxy-7-methyl-6-(2-oxoheptyl)-3-[(E)-prop-1-enyl]-6H-isochromen-8-one |
|---|---|
| PubChem CID | 163193292 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (6S,7R)-7-hydroxy-7-methyl-6-(2-oxoheptyl)-3-[(E)-prop-1-enyl]-6H-isochromen-8-one |
| SMILES | C/C=C/C1=CC2=C[C@H](CC(=O)CCCCC)[C@@](C)(O)C(=O)C2=CO1 |
| InChI | InChI=1S/C20H26O4/c1-4-6-7-9-16(21)12-15-10-14-11-17(8-5-2)24-13-18(14)19(22)20(15,3)23/h5,8,10-11,13,15,23H,4,6-7,9,12H2,1-3H3/b8-5+/t15-,20-/m1/s1 |
| InChIKey | MIHSWRHCWJWHMB-KRSZBIKMSA-N |
| XLogP | 3.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|