C20H26O4 — CID 163003849
5-[(1R,8aR)-7,8,8a-trihydroxy-2-methyl-6-propan-2-yl-1H-naphthalen-1-yl]-2-methylpent-1-en-3-one (PubChem CID 163003849) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is 5-[(1R,8aR)-7,8,8a-trihydroxy-2-methyl-6-propan-2-yl-1H-naphthalen-1-yl]-2-methylpent-1-en-3-one.
| Compound Name | 5-[(1R,8aR)-7,8,8a-trihydroxy-2-methyl-6-propan-2-yl-1H-naphthalen-1-yl]-2-methylpent-1-en-3-one |
|---|---|
| PubChem CID | 163003849 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 5-[(1R,8aR)-7,8,8a-trihydroxy-2-methyl-6-propan-2-yl-1H-naphthalen-1-yl]-2-methylpent-1-en-3-one |
| SMILES | C=C(C)C(=O)CC[C@@H]1C(C)=CC=C2C=C(C(C)C)C(O)=C(O)[C@]21O |
| InChI | InChI=1S/C20H26O4/c1-11(2)15-10-14-7-6-13(5)16(8-9-17(21)12(3)4)20(14,24)19(23)18(15)22/h6-7,10-11,16,22-24H,3,8-9H2,1-2,4-5H3/t16-,20+/m1/s1 |
| InChIKey | MJMYYKNIGJXDGR-UZLBHIALSA-N |
| XLogP | 4.07 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|