C20H24O2 — CID 162871303
(1Z,5S,12Z)-5-hydroxy-12-methyl-7-methylidene-3-propan-2-yltricyclo[7.5.1.05,15]pentadeca-1(14),2,9(15),12-tetraen-4-one (PubChem CID 162871303) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is (1Z,5S,12Z)-5-hydroxy-12-methyl-7-methylidene-3-propan-2-yltricyclo[7.5.1.05,15]pentadeca-1(14),2,9(15),12-tetraen-4-one.
| Compound Name | (1Z,5S,12Z)-5-hydroxy-12-methyl-7-methylidene-3-propan-2-yltricyclo[7.5.1.05,15]pentadeca-1(14),2,9(15),12-tetraen-4-one |
|---|---|
| PubChem CID | 162871303 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (1Z,5S,12Z)-5-hydroxy-12-methyl-7-methylidene-3-propan-2-yltricyclo[7.5.1.05,15]pentadeca-1(14),2,9(15),12-tetraen-4-one |
| SMILES | C=C1CC2=C3/C(=C\C=C(\C)CC2)C=C(C(C)C)C(=O)[C@]3(O)C1 |
| InChI | InChI=1S/C20H24O2/c1-12(2)17-10-16-8-6-13(3)5-7-15-9-14(4)11-20(22,18(15)16)19(17)21/h6,8,10,12,22H,4-5,7,9,11H2,1-3H3/b13-6-,16-8-/t20-/m0/s1 |
| InChIKey | ZIVKXPOGSKSQTF-DOBJVIKBSA-N |
| XLogP | 4.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|