C17H28O3 — CID 170990415
(5R)-5-heptyl-5-hydroxy-3-(3-hydroxy-3-methylbut-1-enyl)cyclopent-2-en-1-one (PubChem CID 170990415) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is (5R)-5-heptyl-5-hydroxy-3-(3-hydroxy-3-methylbut-1-enyl)cyclopent-2-en-1-one.
| Compound Name | (5R)-5-heptyl-5-hydroxy-3-(3-hydroxy-3-methylbut-1-enyl)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 170990415 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | (5R)-5-heptyl-5-hydroxy-3-(3-hydroxy-3-methylbut-1-enyl)cyclopent-2-en-1-one |
| SMILES | CCCCCCC[C@@]1(O)CC(C=CC(C)(C)O)=CC1=O |
| InChI | InChI=1S/C17H28O3/c1-4-5-6-7-8-10-17(20)13-14(12-15(17)18)9-11-16(2,3)19/h9,11-12,19-20H,4-8,10,13H2,1-3H3/t17-/m1/s1 |
| InChIKey | AFZOPUOXGZWJOY-QGZVFWFLSA-N |
| XLogP | 3.30 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|